C14H19NO4S — CID 10709136
(1R,11bR)-9,10-dimethoxy-1-methyl-2,6,7,11b-tetrahydro-1H-oxathiazino[4,3-a]isoquinoline 4-oxide (PubChem CID 10709136) has the molecular formula C14H19NO4S and a molecular weight of 297.38 g/mol. Its IUPAC name is (1R,11bR)-9,10-dimethoxy-1-methyl-2,6,7,11b-tetrahydro-1H-oxathiazino[4,3-a]isoquinoline 4-oxide.
| Compound Name | (1R,11bR)-9,10-dimethoxy-1-methyl-2,6,7,11b-tetrahydro-1H-oxathiazino[4,3-a]isoquinoline 4-oxide |
|---|---|
| PubChem CID | 10709136 |
| Molecular Formula | C14H19NO4S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.10 |
| IUPAC Name | (1R,11bR)-9,10-dimethoxy-1-methyl-2,6,7,11b-tetrahydro-1H-oxathiazino[4,3-a]isoquinoline 4-oxide |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@@H](C)COS(=O)N1CC2 |
| InChI | InChI=1S/C14H19NO4S/c1-9-8-19-20(16)15-5-4-10-6-12(17-2)13(18-3)7-11(10)14(9)15/h6-7,9,14H,4-5,8H2,1-3H3/t9-,14+,20?/m0/s1 |
| InChIKey | HCQFPGAAYORRRS-HXOCVLCLSA-N |
| XLogP | 1.85 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |