C15H21NO4 — CID 14595352
[(1S,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol (PubChem CID 14595352) has the molecular formula C15H21NO4 and a molecular weight of 279.34 g/mol. Its IUPAC name is [(1S,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol.
| Compound Name | [(1S,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol |
|---|---|
| PubChem CID | 14595352 |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.34 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | [(1S,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@@H](CO)COCN1CC2 |
| InChI | InChI=1S/C15H21NO4/c1-18-13-5-10-3-4-16-9-20-8-11(7-17)15(16)12(10)6-14(13)19-2/h5-6,11,15,17H,3-4,7-9H2,1-2H3/t11-,15+/m0/s1 |
| InChIKey | LZGYAQMRFWSZOG-XHDPSFHLSA-N |
| XLogP | 1.20 |
| TPSA | 51.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |