C21H24N2O4 — CID 14595324
[(1R,11bR)-9,10-dimethoxy-4-phenylimino-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol (PubChem CID 14595324) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is [(1R,11bR)-9,10-dimethoxy-4-phenylimino-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol.
| Compound Name | [(1R,11bR)-9,10-dimethoxy-4-phenylimino-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol |
|---|---|
| PubChem CID | 14595324 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | [(1R,11bR)-9,10-dimethoxy-4-phenylimino-2,6,7,11b-tetrahydro-1H-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methanol |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@H](CO)CO/C(=N\c3ccccc3)N1CC2 |
| InChI | InChI=1S/C21H24N2O4/c1-25-18-10-14-8-9-23-20(17(14)11-19(18)26-2)15(12-24)13-27-21(23)22-16-6-4-3-5-7-16/h3-7,10-11,15,20,24H,8-9,12-13H2,1-2H3/b22-21-/t15-,20-/m1/s1 |
| InChIKey | JMQJHMDLIMLKCV-SPPGNOEWSA-N |
| XLogP | 2.93 |
| TPSA | 63.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|