C21H24N2O3 — CID 23243245
(10bR)-8,9-dimethoxy-N-[(1S)-1-phenylethyl]-3,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-1-imine (PubChem CID 23243245) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is (10bR)-8,9-dimethoxy-N-[(1S)-1-phenylethyl]-3,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-1-imine.
| Compound Name | (10bR)-8,9-dimethoxy-N-[(1S)-1-phenylethyl]-3,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-1-imine |
|---|---|
| PubChem CID | 23243245 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | (10bR)-8,9-dimethoxy-N-[(1S)-1-phenylethyl]-3,5,6,10b-tetrahydro-[1,3]oxazolo[4,3-a]isoquinolin-1-imine |
| SMILES | COc1cc2c(cc1OC)[C@@H]1/C(=N/[C@@H](C)c3ccccc3)OCN1CC2 |
| InChI | InChI=1S/C21H24N2O3/c1-14(15-7-5-4-6-8-15)22-21-20-17-12-19(25-3)18(24-2)11-16(17)9-10-23(20)13-26-21/h4-8,11-12,14,20H,9-10,13H2,1-3H3/b22-21-/t14-,20+/m0/s1 |
| InChIKey | JYTIPHKXBMIUMH-VBUHVHTFSA-N |
| XLogP | 3.75 |
| TPSA | 43.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|