C22H25NO5 — CID 14595366
[(1R,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methyl benzoate (PubChem CID 14595366) has the molecular formula C22H25NO5 and a molecular weight of 383.44 g/mol. Its IUPAC name is [(1R,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methyl benzoate.
| Compound Name | [(1R,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methyl benzoate |
|---|---|
| PubChem CID | 14595366 |
| Molecular Formula | C22H25NO5 |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | [(1R,11bR)-9,10-dimethoxy-1,2,4,6,7,11b-hexahydro-[1,3]oxazino[4,3-a]isoquinolin-1-yl]methyl benzoate |
| SMILES | COc1cc2c(cc1OC)[C@H]1[C@@H](COC(=O)c3ccccc3)COCN1CC2 |
| InChI | InChI=1S/C22H25NO5/c1-25-19-10-16-8-9-23-14-27-12-17(21(23)18(16)11-20(19)26-2)13-28-22(24)15-6-4-3-5-7-15/h3-7,10-11,17,21H,8-9,12-14H2,1-2H3/t17-,21-/m1/s1 |
| InChIKey | XKWKUYPUNZEJMB-DYESRHJHSA-N |
| XLogP | 3.06 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |