C12H17NO2 — CID 62375762
6,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 62375762) has the molecular formula C12H17NO2 and a molecular weight of 207.27 g/mol. Its IUPAC name is 6,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 62375762 |
| Molecular Formula | C12H17NO2 |
| Molecular Weight | 207.27 g/mol |
| Exact Mass | 207.13 |
| IUPAC Name | 6,8-dimethoxy-1-methyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(c(OC)c1)C(C)NCC2 |
| InChI | InChI=1S/C12H17NO2/c1-8-12-9(4-5-13-8)6-10(14-2)7-11(12)15-3/h6-8,13H,4-5H2,1-3H3 |
| InChIKey | CFLFVRDTBKUFGC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |