C13H19NO2 — CID 64687584
5,7-dimethoxy-3,4-dimethyl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 64687584) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is 5,7-dimethoxy-3,4-dimethyl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5,7-dimethoxy-3,4-dimethyl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 64687584 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | 5,7-dimethoxy-3,4-dimethyl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1cc2c(c(OC)c1)C(C)C(C)NC2 |
| InChI | InChI=1S/C13H19NO2/c1-8-9(2)14-7-10-5-11(15-3)6-12(16-4)13(8)10/h5-6,8-9,14H,7H2,1-4H3 |
| InChIKey | DOVNOHHJNRWDOD-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |