C13H20ClNO4 — CID 171192526
(3R)-3-(2,4,6-trimethoxyphenyl)morpholine;hydrochloride (PubChem CID 171192526) has the molecular formula C13H20ClNO4 and a molecular weight of 289.76 g/mol. Its IUPAC name is (3R)-3-(2,4,6-trimethoxyphenyl)morpholine;hydrochloride.
| Compound Name | (3R)-3-(2,4,6-trimethoxyphenyl)morpholine;hydrochloride |
|---|---|
| PubChem CID | 171192526 |
| Molecular Formula | C13H20ClNO4 |
| Molecular Weight | 289.76 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | (3R)-3-(2,4,6-trimethoxyphenyl)morpholine;hydrochloride |
| SMILES | COc1cc(OC)c([C@@H]2COCCN2)c(OC)c1.Cl |
| InChI | InChI=1S/C13H19NO4.ClH/c1-15-9-6-11(16-2)13(12(7-9)17-3)10-8-18-5-4-14-10;/h6-7,10,14H,4-5,8H2,1-3H3;1H/t10-;/m0./s1 |
| InChIKey | XAOPUYNNXVDDMY-PPHPATTJSA-N |
| XLogP | 1.80 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.76 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |