C13H13F6NO2 — CID 171193437
(3S)-3-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]morpholine (PubChem CID 171193437) has the molecular formula C13H13F6NO2 and a molecular weight of 329.24 g/mol. Its IUPAC name is (3S)-3-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]morpholine.
| Compound Name | (3S)-3-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]morpholine |
|---|---|
| PubChem CID | 171193437 |
| Molecular Formula | C13H13F6NO2 |
| Molecular Weight | 329.24 g/mol |
| Exact Mass | 329.09 |
| IUPAC Name | (3S)-3-[2-methoxy-4,6-bis(trifluoromethyl)phenyl]morpholine |
| SMILES | COc1cc(C(F)(F)F)cc(C(F)(F)F)c1[C@H]1COCCN1 |
| InChI | InChI=1S/C13H13F6NO2/c1-21-10-5-7(12(14,15)16)4-8(13(17,18)19)11(10)9-6-22-3-2-20-9/h4-5,9,20H,2-3,6H2,1H3/t9-/m1/s1 |
| InChIKey | UJIODCNHYAMMEB-SECBINFHSA-N |
| XLogP | 3.39 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.24 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |