C13H17NO3 — CID 102347263
(1R)-6,8-dimethoxy-1,2-dimethyl-1,4-dihydroisoquinolin-3-one (PubChem CID 102347263) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is (1R)-6,8-dimethoxy-1,2-dimethyl-1,4-dihydroisoquinolin-3-one.
| Compound Name | (1R)-6,8-dimethoxy-1,2-dimethyl-1,4-dihydroisoquinolin-3-one |
|---|---|
| PubChem CID | 102347263 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | (1R)-6,8-dimethoxy-1,2-dimethyl-1,4-dihydroisoquinolin-3-one |
| SMILES | COc1cc2c(c(OC)c1)[C@@H](C)N(C)C(=O)C2 |
| InChI | InChI=1S/C13H17NO3/c1-8-13-9(6-12(15)14(8)2)5-10(16-3)7-11(13)17-4/h5,7-8H,6H2,1-4H3/t8-/m1/s1 |
| InChIKey | SBQJJNGUEZYZGJ-MRVPVSSYSA-N |
| XLogP | 1.78 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |