C20H25NO2 — CID 3725456
2-benzyl-6,8-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 3725456) has the molecular formula C20H25NO2 and a molecular weight of 311.43 g/mol. Its IUPAC name is 2-benzyl-6,8-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | 2-benzyl-6,8-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 3725456 |
| Molecular Formula | C20H25NO2 |
| Molecular Weight | 311.43 g/mol |
| Exact Mass | 311.19 |
| IUPAC Name | 2-benzyl-6,8-dimethoxy-1,3-dimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc2c(c(OC)c1)C(C)N(Cc1ccccc1)C(C)C2 |
| InChI | InChI=1S/C20H25NO2/c1-14-10-17-11-18(22-3)12-19(23-4)20(17)15(2)21(14)13-16-8-6-5-7-9-16/h5-9,11-12,14-15H,10,13H2,1-4H3 |
| InChIKey | RGYCJCNJSUCUCI-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.43 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |