C26H28INO2 — CID 11071310
(1S,3S)-2-benzyl-5-iodo-8-methoxy-1,3-dimethyl-6-phenylmethoxy-3,4-dihydro-1H-isoquinoline (PubChem CID 11071310) has the molecular formula C26H28INO2 and a molecular weight of 513.42 g/mol. Its IUPAC name is (1S,3S)-2-benzyl-5-iodo-8-methoxy-1,3-dimethyl-6-phenylmethoxy-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1S,3S)-2-benzyl-5-iodo-8-methoxy-1,3-dimethyl-6-phenylmethoxy-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 11071310 |
| Molecular Formula | C26H28INO2 |
| Molecular Weight | 513.42 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | (1S,3S)-2-benzyl-5-iodo-8-methoxy-1,3-dimethyl-6-phenylmethoxy-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc(OCc2ccccc2)c(I)c2c1[C@H](C)N(Cc1ccccc1)[C@@H](C)C2 |
| InChI | InChI=1S/C26H28INO2/c1-18-14-22-25(19(2)28(18)16-20-10-6-4-7-11-20)23(29-3)15-24(26(22)27)30-17-21-12-8-5-9-13-21/h4-13,15,18-19H,14,16-17H2,1-3H3/t18-,19-/m0/s1 |
| InChIKey | AWHLJWROPOTVJU-OALUTQOASA-N |
| XLogP | 6.39 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.42 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|