C10H13NO2 — CID 84656928
1-methyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol (PubChem CID 84656928) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol.
| Compound Name | 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
|---|---|
| PubChem CID | 84656928 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 1-methyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
| SMILES | CC1NCCc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C10H13NO2/c1-6-10-7(2-3-11-6)4-8(12)5-9(10)13/h4-6,11-13H,2-3H2,1H3 |
| InChIKey | SRKYUFSSBLFNNA-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|