C11H15NO2 — CID 22864084
(3R)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol (PubChem CID 22864084) has the molecular formula C11H15NO2 and a molecular weight of 193.25 g/mol. Its IUPAC name is (3R)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol.
| Compound Name | (3R)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
|---|---|
| PubChem CID | 22864084 |
| Molecular Formula | C11H15NO2 |
| Molecular Weight | 193.25 g/mol |
| Exact Mass | 193.11 |
| IUPAC Name | (3R)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
| SMILES | CC1N[C@H](C)Cc2cc(O)cc(O)c21 |
| InChI | InChI=1S/C11H15NO2/c1-6-3-8-4-9(13)5-10(14)11(8)7(2)12-6/h4-7,12-14H,3H2,1-2H3/t6-,7?/m1/s1 |
| InChIKey | XQNMFZHTIUPCRA-ULUSZKPHSA-N |
| XLogP | 1.69 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.25 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|