C11H14BrNO — CID 132500910
(1R,3R)-5-bromo-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol (PubChem CID 132500910) has the molecular formula C11H14BrNO and a molecular weight of 256.14 g/mol. Its IUPAC name is (1R,3R)-5-bromo-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol.
| Compound Name | (1R,3R)-5-bromo-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
|---|---|
| PubChem CID | 132500910 |
| Molecular Formula | C11H14BrNO |
| Molecular Weight | 256.14 g/mol |
| Exact Mass | 255.03 |
| IUPAC Name | (1R,3R)-5-bromo-1,3-dimethyl-1,2,3,4-tetrahydroisoquinolin-8-ol |
| SMILES | C[C@@H]1Cc2c(Br)ccc(O)c2[C@@H](C)N1 |
| InChI | InChI=1S/C11H14BrNO/c1-6-5-8-9(12)3-4-10(14)11(8)7(2)13-6/h3-4,6-7,13-14H,5H2,1-2H3/t6-,7-/m1/s1 |
| InChIKey | RJRQFSJVJMGASP-RNFRBKRXSA-N |
| XLogP | 2.75 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.14 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|