C24H27NO4 — CID 5016519
5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol (PubChem CID 5016519) has the molecular formula C24H27NO4 and a molecular weight of 393.48 g/mol. Its IUPAC name is 5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol.
| Compound Name | 5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
|---|---|
| PubChem CID | 5016519 |
| Molecular Formula | C24H27NO4 |
| Molecular Weight | 393.48 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | 5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,3-dimethyl-1,2,3,4-tetrahydroisoquinoline-6,8-diol |
| SMILES | COc1ccc(-c2c(O)cc(O)c3c2CC(C)NC3C)c2cc(C)cc(OC)c12 |
| InChI | InChI=1S/C24H27NO4/c1-12-8-16-15(6-7-20(28-4)24(16)21(9-12)29-5)23-17-10-13(2)25-14(3)22(17)18(26)11-19(23)27/h6-9,11,13-14,25-27H,10H2,1-5H3 |
| InChIKey | PLLKZICNVDBVIE-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 70.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.48 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|