C25H29NO4 — CID 163066508
(1R,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline-6,8-diol (PubChem CID 163066508) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is (1R,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline-6,8-diol.
| Compound Name | (1R,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline-6,8-diol |
|---|---|
| PubChem CID | 163066508 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | (1R,3R)-5-(4,5-dimethoxy-7-methylnaphthalen-1-yl)-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline-6,8-diol |
| SMILES | COc1ccc(-c2c(O)cc(O)c3c2C[C@@H](C)N(C)[C@@H]3C)c2cc(C)cc(OC)c12 |
| InChI | InChI=1S/C25H29NO4/c1-13-9-17-16(7-8-21(29-5)25(17)22(10-13)30-6)24-18-11-14(2)26(4)15(3)23(18)19(27)12-20(24)28/h7-10,12,14-15,27-28H,11H2,1-6H3/t14-,15-/m1/s1 |
| InChIKey | XPNIPHCKKGOJOU-HUUCEWRRSA-N |
| XLogP | 5.18 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|