C26H31NO4 — CID 163058609
(1R,3S)-5-(4,5-dimethoxynaphthalen-1-yl)-6,8-dimethoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline (PubChem CID 163058609) has the molecular formula C26H31NO4 and a molecular weight of 421.54 g/mol. Its IUPAC name is (1R,3S)-5-(4,5-dimethoxynaphthalen-1-yl)-6,8-dimethoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline.
| Compound Name | (1R,3S)-5-(4,5-dimethoxynaphthalen-1-yl)-6,8-dimethoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline |
|---|---|
| PubChem CID | 163058609 |
| Molecular Formula | C26H31NO4 |
| Molecular Weight | 421.54 g/mol |
| Exact Mass | 421.23 |
| IUPAC Name | (1R,3S)-5-(4,5-dimethoxynaphthalen-1-yl)-6,8-dimethoxy-1,2,3-trimethyl-3,4-dihydro-1H-isoquinoline |
| SMILES | COc1cc(OC)c2c(c1-c1ccc(OC)c3c(OC)cccc13)C[C@H](C)N(C)[C@@H]2C |
| InChI | InChI=1S/C26H31NO4/c1-15-13-19-24(16(2)27(15)3)22(30-6)14-23(31-7)25(19)18-11-12-21(29-5)26-17(18)9-8-10-20(26)28-4/h8-12,14-16H,13H2,1-7H3/t15-,16+/m0/s1 |
| InChIKey | JTWIKSOWCMKKAL-JKSUJKDBSA-N |
| XLogP | 5.48 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.54 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |