C10H13BrN2 — CID 84702415
8-bromo-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-amine (PubChem CID 84702415) has the molecular formula C10H13BrN2 and a molecular weight of 241.13 g/mol. Its IUPAC name is 8-bromo-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-amine.
| Compound Name | 8-bromo-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-amine |
|---|---|
| PubChem CID | 84702415 |
| Molecular Formula | C10H13BrN2 |
| Molecular Weight | 241.13 g/mol |
| Exact Mass | 240.03 |
| IUPAC Name | 8-bromo-1-methyl-1,2,3,4-tetrahydroisoquinolin-7-amine |
| SMILES | CC1NCCc2ccc(N)c(Br)c21 |
| InChI | InChI=1S/C10H13BrN2/c1-6-9-7(4-5-13-6)2-3-8(12)10(9)11/h2-3,6,13H,4-5,12H2,1H3 |
| InChIKey | KNKLUURYSGBHJK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.13 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|