C10H12N2O3 — CID 59585598
6-methoxy-5-nitro-1,2,3,4-tetrahydroisoquinoline (PubChem CID 59585598) has the molecular formula C10H12N2O3 and a molecular weight of 208.22 g/mol. Its IUPAC name is 6-methoxy-5-nitro-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 6-methoxy-5-nitro-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 59585598 |
| Molecular Formula | C10H12N2O3 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.08 |
| IUPAC Name | 6-methoxy-5-nitro-1,2,3,4-tetrahydroisoquinoline |
| SMILES | COc1ccc2c(c1[N+](=O)[O-])CCNC2 |
| InChI | InChI=1S/C10H12N2O3/c1-15-9-3-2-7-6-11-5-4-8(7)10(9)12(13)14/h2-3,11H,4-6H2,1H3 |
| InChIKey | RXFMVJCQUZYHLG-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|