C17H17NO3 — CID 82583495
3-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid (PubChem CID 82583495) has the molecular formula C17H17NO3 and a molecular weight of 283.33 g/mol. Its IUPAC name is 3-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid.
| Compound Name | 3-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid |
|---|---|
| PubChem CID | 82583495 |
| Molecular Formula | C17H17NO3 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 3-(6-methoxy-1,2,3,4-tetrahydroisoquinolin-5-yl)benzoic acid |
| SMILES | COc1ccc2c(c1-c1cccc(C(=O)O)c1)CCNC2 |
| InChI | InChI=1S/C17H17NO3/c1-21-15-6-5-13-10-18-8-7-14(13)16(15)11-3-2-4-12(9-11)17(19)20/h2-6,9,18H,7-8,10H2,1H3,(H,19,20) |
| InChIKey | HWFRBMYBNXVFQQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |