C23H22O5 — CID 66858506
3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid (PubChem CID 66858506) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid.
| Compound Name | 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 66858506 |
| Molecular Formula | C23H22O5 |
| Molecular Weight | 378.42 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid |
| SMILES | COc1ccc(CCOc2cccc(-c3cccc(C(=O)O)c3)c2)cc1OC |
| InChI | InChI=1S/C23H22O5/c1-26-21-10-9-16(13-22(21)27-2)11-12-28-20-8-4-6-18(15-20)17-5-3-7-19(14-17)23(24)25/h3-10,13-15H,11-12H2,1-2H3,(H,24,25) |
| InChIKey | NFUWVMUPPRLHON-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |