3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid

C23H22O5 — CID 66858506

IUPAC3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid
SMILESCOc1ccc(CCOc2cccc(-c3cccc(C(=O)O)c3)c2)cc1OC
InChIInChI=1S/C23H22O5/c1-26-21-10-9-16(13-22(21)27-2)11-12-28-20-8-4-6-18(15-20)17-5-3-7-19(14-17)23(24)25/h3-10,13-15H,11-12H2,1-2H3,(H,24,25)
InChIKeyNFUWVMUPPRLHON-UHFFFAOYSA-N
MW378.42 g/mol
LogP4.69
Rot. Bonds8

About 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid

3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid (PubChem CID 66858506) has the molecular formula C23H22O5 and a molecular weight of 378.42 g/mol. Its IUPAC name is 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid.

Molecular Properties

Compound Name3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid
PubChem CID66858506
Molecular FormulaC23H22O5
Molecular Weight378.42 g/mol
Exact Mass378.15
IUPAC Name3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid
SMILESCOc1ccc(CCOc2cccc(-c3cccc(C(=O)O)c3)c2)cc1OC
InChIInChI=1S/C23H22O5/c1-26-21-10-9-16(13-22(21)27-2)11-12-28-20-8-4-6-18(15-20)17-5-3-7-19(14-17)23(24)25/h3-10,13-15H,11-12H2,1-2H3,(H,24,25)
InChIKeyNFUWVMUPPRLHON-UHFFFAOYSA-N
XLogP4.69
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds8
Heavy Atoms28
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500378.42
LogP ≤ 54.69
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid?
The IUPAC name of 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid (CID 66858506) is 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid.
What is the SMILES notation for 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid?
The canonical SMILES for 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid is COc1ccc(CCOc2cccc(-c3cccc(C(=O)O)c3)c2)cc1OC.
What is the InChIKey of 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid?
The InChIKey is NFUWVMUPPRLHON-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22O5/c1-26-21-10-9-16(13-22(21)27-2)11-12-28-20-8-4-6-18(15-20)17-5-3-7-19(14-17)23(24)25/h3-10,13-15H,11-12H2,1-2H3,(H,24,25).
What are the key properties of 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid?
3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid has a molecular weight of 378.42 g/mol, XLogP of 4.69, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[2-(3,4-dimethoxyphenyl)ethoxy]phenyl]benzoic acid is sourced from PubChem (CID 66858506), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).