C18H21NO5 — CID 122030518
3-[[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylamino]methyl]benzoic acid (PubChem CID 122030518) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 3-[[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylamino]methyl]benzoic acid.
| Compound Name | 3-[[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylamino]methyl]benzoic acid |
|---|---|
| PubChem CID | 122030518 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 3-[[[4-(2-hydroxyethoxy)-3-methoxyphenyl]methylamino]methyl]benzoic acid |
| SMILES | COc1cc(CNCc2cccc(C(=O)O)c2)ccc1OCCO |
| InChI | InChI=1S/C18H21NO5/c1-23-17-10-14(5-6-16(17)24-8-7-20)12-19-11-13-3-2-4-15(9-13)18(21)22/h2-6,9-10,19-20H,7-8,11-12H2,1H3,(H,21,22) |
| InChIKey | HSBZOSPHLCQIEH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |