C29H30N4O5 — CID 11214463
3-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-4-morpholin-4-ylquinazolin-6-yl]benzamide (PubChem CID 11214463) has the molecular formula C29H30N4O5 and a molecular weight of 514.58 g/mol. Its IUPAC name is 3-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-4-morpholin-4-ylquinazolin-6-yl]benzamide.
| Compound Name | 3-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-4-morpholin-4-ylquinazolin-6-yl]benzamide |
|---|---|
| PubChem CID | 11214463 |
| Molecular Formula | C29H30N4O5 |
| Molecular Weight | 514.58 g/mol |
| Exact Mass | 514.22 |
| IUPAC Name | 3-[2-[2-(3,4-dimethoxyphenyl)ethoxy]-4-morpholin-4-ylquinazolin-6-yl]benzamide |
| SMILES | COc1ccc(CCOc2nc(N3CCOCC3)c3cc(-c4cccc(C(N)=O)c4)ccc3n2)cc1OC |
| InChI | InChI=1S/C29H30N4O5/c1-35-25-9-6-19(16-26(25)36-2)10-13-38-29-31-24-8-7-21(20-4-3-5-22(17-20)27(30)34)18-23(24)28(32-29)33-11-14-37-15-12-33/h3-9,16-18H,10-15H2,1-2H3,(H2,30,34) |
| InChIKey | KPNGSFSGJKDOHH-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 109.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.58 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |