C20H24O5 — CID 67720502
tert-butyl 2-[3-(3,4-dimethoxyphenyl)phenoxy]acetate (PubChem CID 67720502) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is tert-butyl 2-[3-(3,4-dimethoxyphenyl)phenoxy]acetate.
| Compound Name | tert-butyl 2-[3-(3,4-dimethoxyphenyl)phenoxy]acetate |
|---|---|
| PubChem CID | 67720502 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | tert-butyl 2-[3-(3,4-dimethoxyphenyl)phenoxy]acetate |
| SMILES | COc1ccc(-c2cccc(OCC(=O)OC(C)(C)C)c2)cc1OC |
| InChI | InChI=1S/C20H24O5/c1-20(2,3)25-19(21)13-24-16-8-6-7-14(11-16)15-9-10-17(22-4)18(12-15)23-5/h6-12H,13H2,1-5H3 |
| InChIKey | ZMXDLIURDWRJMO-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |