C17H18N2O2 — CID 56875194
2-methoxy-5-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzamide (PubChem CID 56875194) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2-methoxy-5-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzamide.
| Compound Name | 2-methoxy-5-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzamide |
|---|---|
| PubChem CID | 56875194 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2-methoxy-5-(1,2,3,4-tetrahydroisoquinolin-5-yl)benzamide |
| SMILES | COc1ccc(-c2cccc3c2CCNC3)cc1C(N)=O |
| InChI | InChI=1S/C17H18N2O2/c1-21-16-6-5-11(9-15(16)17(18)20)13-4-2-3-12-10-19-8-7-14(12)13/h2-6,9,19H,7-8,10H2,1H3,(H2,18,20) |
| InChIKey | FVHXSCLDFXWXBX-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |