C18H20N2O2 — CID 95554001
(2R)-2-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)phenoxy]propanamide (PubChem CID 95554001) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is (2R)-2-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)phenoxy]propanamide.
| Compound Name | (2R)-2-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)phenoxy]propanamide |
|---|---|
| PubChem CID | 95554001 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (2R)-2-[3-(1,2,3,4-tetrahydroisoquinolin-5-yl)phenoxy]propanamide |
| SMILES | C[C@@H](Oc1cccc(-c2cccc3c2CCNC3)c1)C(N)=O |
| InChI | InChI=1S/C18H20N2O2/c1-12(18(19)21)22-15-6-2-4-13(10-15)16-7-3-5-14-11-20-9-8-17(14)16/h2-7,10,12,20H,8-9,11H2,1H3,(H2,19,21)/t12-/m1/s1 |
| InChIKey | WPUNWEHLYKPRPV-GFCCVEGCSA-N |
| XLogP | 2.25 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |