C17H19NO4 — CID 56702109
2-[3-(2,6-dimethoxyphenyl)phenoxy]propanamide (PubChem CID 56702109) has the molecular formula C17H19NO4 and a molecular weight of 301.34 g/mol. Its IUPAC name is 2-[3-(2,6-dimethoxyphenyl)phenoxy]propanamide.
| Compound Name | 2-[3-(2,6-dimethoxyphenyl)phenoxy]propanamide |
|---|---|
| PubChem CID | 56702109 |
| Molecular Formula | C17H19NO4 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | 2-[3-(2,6-dimethoxyphenyl)phenoxy]propanamide |
| SMILES | COc1cccc(OC)c1-c1cccc(OC(C)C(N)=O)c1 |
| InChI | InChI=1S/C17H19NO4/c1-11(17(18)19)22-13-7-4-6-12(10-13)16-14(20-2)8-5-9-15(16)21-3/h4-11H,1-3H3,(H2,18,19) |
| InChIKey | NFEBBHKGJRBQQJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |