C27H34N2O10 — CID 12800935
4,5,6-triethoxy-7-nitro-3-(6,7,8-trimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-3H-2-benzofuran-1-one (PubChem CID 12800935) has the molecular formula C27H34N2O10 and a molecular weight of 546.57 g/mol. Its IUPAC name is 4,5,6-triethoxy-7-nitro-3-(6,7,8-trimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-3H-2-benzofuran-1-one.
| Compound Name | 4,5,6-triethoxy-7-nitro-3-(6,7,8-trimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 12800935 |
| Molecular Formula | C27H34N2O10 |
| Molecular Weight | 546.57 g/mol |
| Exact Mass | 546.22 |
| IUPAC Name | 4,5,6-triethoxy-7-nitro-3-(6,7,8-trimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-3H-2-benzofuran-1-one |
| SMILES | CCOc1c(OCC)c2c(c([N+](=O)[O-])c1OCC)C(=O)OC2C1c2c(cc(OC)c(OC)c2OC)CCN1C |
| InChI | InChI=1S/C27H34N2O10/c1-8-36-24-18-17(20(29(31)32)25(37-9-2)26(24)38-10-3)27(30)39-22(18)19-16-14(11-12-28(19)4)13-15(33-5)21(34-6)23(16)35-7/h13,19,22H,8-12H2,1-7H3 |
| InChIKey | FJTBPKFOWBEFKL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 128.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.57 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|