C26H32N2O9 — CID 20560980
3-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-4,5,6-triethoxy-7-nitro-3H-2-benzofuran-1-one (PubChem CID 20560980) has the molecular formula C26H32N2O9 and a molecular weight of 516.55 g/mol. Its IUPAC name is 3-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-4,5,6-triethoxy-7-nitro-3H-2-benzofuran-1-one.
| Compound Name | 3-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-4,5,6-triethoxy-7-nitro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 20560980 |
| Molecular Formula | C26H32N2O9 |
| Molecular Weight | 516.55 g/mol |
| Exact Mass | 516.21 |
| IUPAC Name | 3-(6,7-dimethoxy-2-methyl-3,4-dihydro-1H-isoquinolin-1-yl)-4,5,6-triethoxy-7-nitro-3H-2-benzofuran-1-one |
| SMILES | CCOc1c(OCC)c2c(c([N+](=O)[O-])c1OCC)C(=O)OC2C1c2cc(OC)c(OC)cc2CCN1C |
| InChI | InChI=1S/C26H32N2O9/c1-7-34-23-19-18(21(28(30)31)24(35-8-2)25(23)36-9-3)26(29)37-22(19)20-15-13-17(33-6)16(32-5)12-14(15)10-11-27(20)4/h12-13,20,22H,7-11H2,1-6H3 |
| InChIKey | NJTHVQVGXRISGZ-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 118.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.55 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|