C11H15NO3 — CID 82230545
6,7-dimethoxy-3-methyl-3,4-dihydro-2H-1,4-benzoxazine (PubChem CID 82230545) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 6,7-dimethoxy-3-methyl-3,4-dihydro-2H-1,4-benzoxazine.
| Compound Name | 6,7-dimethoxy-3-methyl-3,4-dihydro-2H-1,4-benzoxazine |
|---|---|
| PubChem CID | 82230545 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 6,7-dimethoxy-3-methyl-3,4-dihydro-2H-1,4-benzoxazine |
| SMILES | COc1cc2c(cc1OC)OCC(C)N2 |
| InChI | InChI=1S/C11H15NO3/c1-7-6-15-9-5-11(14-3)10(13-2)4-8(9)12-7/h4-5,7,12H,6H2,1-3H3 |
| InChIKey | FRMWAJPNLJNCIZ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|