C16H18N2O2 — CID 141058768
4-(5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl)aniline (PubChem CID 141058768) has the molecular formula C16H18N2O2 and a molecular weight of 270.33 g/mol. Its IUPAC name is 4-(5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl)aniline.
| Compound Name | 4-(5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl)aniline |
|---|---|
| PubChem CID | 141058768 |
| Molecular Formula | C16H18N2O2 |
| Molecular Weight | 270.33 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 4-(5,6-dimethoxy-2,3-dihydro-1H-indol-2-yl)aniline |
| SMILES | COc1cc2c(cc1OC)NC(c1ccc(N)cc1)C2 |
| InChI | InChI=1S/C16H18N2O2/c1-19-15-8-11-7-13(10-3-5-12(17)6-4-10)18-14(11)9-16(15)20-2/h3-6,8-9,13,18H,7,17H2,1-2H3 |
| InChIKey | FSYRSFOGBZSBMF-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.33 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|