C20H25NO — CID 4014810
5-butyl-2-(4-methoxy-3-methylphenyl)-2,3-dihydro-1H-indole (PubChem CID 4014810) has the molecular formula C20H25NO and a molecular weight of 295.43 g/mol. Its IUPAC name is 5-butyl-2-(4-methoxy-3-methylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-butyl-2-(4-methoxy-3-methylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4014810 |
| Molecular Formula | C20H25NO |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.19 |
| IUPAC Name | 5-butyl-2-(4-methoxy-3-methylphenyl)-2,3-dihydro-1H-indole |
| SMILES | CCCCc1ccc2c(c1)CC(c1ccc(OC)c(C)c1)N2 |
| InChI | InChI=1S/C20H25NO/c1-4-5-6-15-7-9-18-17(12-15)13-19(21-18)16-8-10-20(22-3)14(2)11-16/h7-12,19,21H,4-6,13H2,1-3H3 |
| InChIKey | XWGSYKPIKRKANB-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |