C12H17NO — CID 141157926
5-butyl-2,3-dihydro-1H-indol-2-ol (PubChem CID 141157926) has the molecular formula C12H17NO and a molecular weight of 191.27 g/mol. Its IUPAC name is 5-butyl-2,3-dihydro-1H-indol-2-ol.
| Compound Name | 5-butyl-2,3-dihydro-1H-indol-2-ol |
|---|---|
| PubChem CID | 141157926 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 5-butyl-2,3-dihydro-1H-indol-2-ol |
| SMILES | CCCCc1ccc2c(c1)CC(O)N2 |
| InChI | InChI=1S/C12H17NO/c1-2-3-4-9-5-6-11-10(7-9)8-12(14)13-11/h5-7,12-14H,2-4,8H2,1H3 |
| InChIKey | YPSCFOSDWBLTPF-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |