About ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate
ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate (PubChem CID 21432732) has the molecular formula C15H20N2O2
and a molecular weight of 260.34 g/mol. Its IUPAC name is ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate |
| PubChem CID | 21432732 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate |
| SMILES | CCCCc1ccc2c(c1)CC(C(=O)OCC)=NN2 |
| InChI | InChI=1S/C15H20N2O2/c1-3-5-6-11-7-8-13-12(9-11)10-14(17-16-13)15(18)19-4-2/h7-9,16H,3-6,10H2,1-2H3 |
| InChIKey | DCUVBDYWMKMREV-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate?
The IUPAC name of ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate (CID 21432732) is ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate.
What is the SMILES notation for ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate?
The canonical SMILES for ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate is CCCCc1ccc2c(c1)CC(C(=O)OCC)=NN2.
What is the InChIKey of ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate?
The InChIKey is DCUVBDYWMKMREV-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20N2O2/c1-3-5-6-11-7-8-13-12(9-11)10-14(17-16-13)15(18)19-4-2/h7-9,16H,3-6,10H2,1-2H3.
What are the key properties of ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate?
ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate has a molecular weight of 260.34 g/mol, XLogP of 2.92, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 6-butyl-1,4-dihydrocinnoline-3-carboxylate is sourced from PubChem (CID 21432732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).