C16H23NO — CID 165476679
2-cyclopentyl-6-ethyl-1,2,3,4-tetrahydroquinolin-3-ol (PubChem CID 165476679) has the molecular formula C16H23NO and a molecular weight of 245.37 g/mol. Its IUPAC name is 2-cyclopentyl-6-ethyl-1,2,3,4-tetrahydroquinolin-3-ol.
| Compound Name | 2-cyclopentyl-6-ethyl-1,2,3,4-tetrahydroquinolin-3-ol |
|---|---|
| PubChem CID | 165476679 |
| Molecular Formula | C16H23NO |
| Molecular Weight | 245.37 g/mol |
| Exact Mass | 245.18 |
| IUPAC Name | 2-cyclopentyl-6-ethyl-1,2,3,4-tetrahydroquinolin-3-ol |
| SMILES | CCc1ccc2c(c1)CC(O)C(C1CCCC1)N2 |
| InChI | InChI=1S/C16H23NO/c1-2-11-7-8-14-13(9-11)10-15(18)16(17-14)12-5-3-4-6-12/h7-9,12,15-18H,2-6,10H2,1H3 |
| InChIKey | BMQZWZGGDTYZRC-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.37 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |