7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid

C14H19NO2 — CID 13406802

IUPAC7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
SMILESCCCCc1ccc2c(c1)CNC(C(=O)O)C2
InChIInChI=1S/C14H19NO2/c1-2-3-4-10-5-6-11-8-13(14(16)17)15-9-12(11)7-10/h5-7,13,15H,2-4,8-9H2,1H3,(H,16,17)
InChIKeyHBAKEHMNJFZBEZ-UHFFFAOYSA-N
MW233.31 g/mol
LogP2.13
Rot. Bonds4

About 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid

7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (PubChem CID 13406802) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.

Molecular Properties

Compound Name7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
PubChem CID13406802
Molecular FormulaC14H19NO2
Molecular Weight233.31 g/mol
Exact Mass233.14
IUPAC Name7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid
SMILESCCCCc1ccc2c(c1)CNC(C(=O)O)C2
InChIInChI=1S/C14H19NO2/c1-2-3-4-10-5-6-11-8-13(14(16)17)15-9-12(11)7-10/h5-7,13,15H,2-4,8-9H2,1H3,(H,16,17)
InChIKeyHBAKEHMNJFZBEZ-UHFFFAOYSA-N
XLogP2.13
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds4
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500233.31
LogP ≤ 52.13
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
The IUPAC name of 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid (CID 13406802) is 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid.
What is the SMILES notation for 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
The canonical SMILES for 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid is CCCCc1ccc2c(c1)CNC(C(=O)O)C2.
What is the InChIKey of 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
The InChIKey is HBAKEHMNJFZBEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NO2/c1-2-3-4-10-5-6-11-8-13(14(16)17)15-9-12(11)7-10/h5-7,13,15H,2-4,8-9H2,1H3,(H,16,17).
What are the key properties of 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid?
7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid has a molecular weight of 233.31 g/mol, XLogP of 2.13, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-butyl-1,2,3,4-tetrahydroisoquinoline-3-carboxylic acid is sourced from PubChem (CID 13406802), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).