C21H27N — CID 5176220
5-tert-butyl-2-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indole (PubChem CID 5176220) has the molecular formula C21H27N and a molecular weight of 293.45 g/mol. Its IUPAC name is 5-tert-butyl-2-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 5-tert-butyl-2-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 5176220 |
| Molecular Formula | C21H27N |
| Molecular Weight | 293.45 g/mol |
| Exact Mass | 293.21 |
| IUPAC Name | 5-tert-butyl-2-(4-propan-2-ylphenyl)-2,3-dihydro-1H-indole |
| SMILES | CC(C)c1ccc(C2Cc3cc(C(C)(C)C)ccc3N2)cc1 |
| InChI | InChI=1S/C21H27N/c1-14(2)15-6-8-16(9-7-15)20-13-17-12-18(21(3,4)5)10-11-19(17)22-20/h6-12,14,20,22H,13H2,1-5H3 |
| InChIKey | NKXVKVXCTVQTAI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.45 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |