C26H37N3O2 — CID 10273870
(2Z)-2-[(4aR,10bR)-9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]-5-piperidin-1-ylpentanenitrile (PubChem CID 10273870) has the molecular formula C26H37N3O2 and a molecular weight of 423.60 g/mol. Its IUPAC name is (2Z)-2-[(4aR,10bR)-9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]-5-piperidin-1-ylpentanenitrile.
| Compound Name | (2Z)-2-[(4aR,10bR)-9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]-5-piperidin-1-ylpentanenitrile |
|---|---|
| PubChem CID | 10273870 |
| Molecular Formula | C26H37N3O2 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.29 |
| IUPAC Name | (2Z)-2-[(4aR,10bR)-9-ethoxy-8-methoxy-2,3,4,4a,5,10b-hexahydro-1H-phenanthridin-6-ylidene]-5-piperidin-1-ylpentanenitrile |
| SMILES | CCOc1cc2c(cc1OC)/C(=C(/C#N)CCCN1CCCCC1)N[C@@H]1CCCC[C@H]21 |
| InChI | InChI=1S/C26H37N3O2/c1-3-31-25-16-21-20-11-5-6-12-23(20)28-26(22(21)17-24(25)30-2)19(18-27)10-9-15-29-13-7-4-8-14-29/h16-17,20,23,28H,3-15H2,1-2H3/b26-19-/t20-,23-/m1/s1 |
| InChIKey | NPQGISOKUJURKT-AEIDIBRGSA-N |
| XLogP | 5.22 |
| TPSA | 57.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|