C20H27NO2 — CID 5293291
ethyl (2Z)-2-(4a,7,10-trimethyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene)acetate (PubChem CID 5293291) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is ethyl (2Z)-2-(4a,7,10-trimethyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene)acetate.
| Compound Name | ethyl (2Z)-2-(4a,7,10-trimethyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene)acetate |
|---|---|
| PubChem CID | 5293291 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | ethyl (2Z)-2-(4a,7,10-trimethyl-1,2,3,4,5,10b-hexahydrophenanthridin-6-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\NC2(C)CCCCC2c2c(C)ccc(C)c21 |
| InChI | InChI=1S/C20H27NO2/c1-5-23-17(22)12-16-19-14(3)10-9-13(2)18(19)15-8-6-7-11-20(15,4)21-16/h9-10,12,15,21H,5-8,11H2,1-4H3/b16-12- |
| InChIKey | TYUKGNSLZLNRDL-VBKFSLOCSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|