C12H18N2O3 — CID 101493316
ethyl (3aS,8aR)-8a-formyl-3a,4,5,6,7,8-hexahydro-1H-cyclohepta[c]pyrazole-3-carboxylate (PubChem CID 101493316) has the molecular formula C12H18N2O3 and a molecular weight of 238.29 g/mol. Its IUPAC name is ethyl (3aS,8aR)-8a-formyl-3a,4,5,6,7,8-hexahydro-1H-cyclohepta[c]pyrazole-3-carboxylate.
| Compound Name | ethyl (3aS,8aR)-8a-formyl-3a,4,5,6,7,8-hexahydro-1H-cyclohepta[c]pyrazole-3-carboxylate |
|---|---|
| PubChem CID | 101493316 |
| Molecular Formula | C12H18N2O3 |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | ethyl (3aS,8aR)-8a-formyl-3a,4,5,6,7,8-hexahydro-1H-cyclohepta[c]pyrazole-3-carboxylate |
| SMILES | CCOC(=O)C1=NN[C@]2(C=O)CCCCC[C@H]12 |
| InChI | InChI=1S/C12H18N2O3/c1-2-17-11(16)10-9-6-4-3-5-7-12(9,8-15)14-13-10/h8-9,14H,2-7H2,1H3/t9-,12+/m1/s1 |
| InChIKey | UQAPFYCREBDSTE-SKDRFNHKSA-N |
| XLogP | 1.03 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|