C13H24N3O2+ — CID 144678628
ethyl 3-(cyclohexylmethyl)-5-methyl-1,2-dihydrotriazol-2-ium-4-carboxylate (PubChem CID 144678628) has the molecular formula C13H24N3O2+ and a molecular weight of 254.35 g/mol. Its IUPAC name is ethyl 3-(cyclohexylmethyl)-5-methyl-1,2-dihydrotriazol-2-ium-4-carboxylate.
| Compound Name | ethyl 3-(cyclohexylmethyl)-5-methyl-1,2-dihydrotriazol-2-ium-4-carboxylate |
|---|---|
| PubChem CID | 144678628 |
| Molecular Formula | C13H24N3O2+ |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | ethyl 3-(cyclohexylmethyl)-5-methyl-1,2-dihydrotriazol-2-ium-4-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N[NH2+]N1CC1CCCCC1 |
| InChI | InChI=1S/C13H23N3O2/c1-3-18-13(17)12-10(2)14-15-16(12)9-11-7-5-4-6-8-11/h11,14-15H,3-9H2,1-2H3/p+1 |
| InChIKey | YVFOWLZZSROKJU-UHFFFAOYSA-O |
| XLogP | 0.66 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|