C27H35N3O5 — CID 102127146
dipropan-2-yl (1R,2S,11R,12R)-15-cycloheptylidene-9-oxo-10,13,14-triazatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-triene-13,14-dicarboxylate (PubChem CID 102127146) has the molecular formula C27H35N3O5 and a molecular weight of 481.59 g/mol. Its IUPAC name is dipropan-2-yl (1R,2S,11R,12R)-15-cycloheptylidene-9-oxo-10,13,14-triazatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-triene-13,14-dicarboxylate.
| Compound Name | dipropan-2-yl (1R,2S,11R,12R)-15-cycloheptylidene-9-oxo-10,13,14-triazatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-triene-13,14-dicarboxylate |
|---|---|
| PubChem CID | 102127146 |
| Molecular Formula | C27H35N3O5 |
| Molecular Weight | 481.59 g/mol |
| Exact Mass | 481.26 |
| IUPAC Name | dipropan-2-yl (1R,2S,11R,12R)-15-cycloheptylidene-9-oxo-10,13,14-triazatetracyclo[10.2.1.02,11.03,8]pentadeca-3,5,7-triene-13,14-dicarboxylate |
| SMILES | CC(C)OC(=O)N1[C@@H]2C(=C3CCCCCC3)[C@@H]([C@H]3c4ccccc4C(=O)N[C@H]32)N1C(=O)OC(C)C |
| InChI | InChI=1S/C27H35N3O5/c1-15(2)34-26(32)29-23-20(17-11-7-5-6-8-12-17)24(30(29)27(33)35-16(3)4)22-21(23)18-13-9-10-14-19(18)25(31)28-22/h9-10,13-16,21-24H,5-8,11-12H2,1-4H3,(H,28,31)/t21-,22+,23-,24+/m0/s1 |
| InChIKey | VBAYYECXENJSDU-UARRHKHWSA-N |
| XLogP | 4.91 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.59 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|