C19H20N2O2 — CID 134840935
(4bS,6aS,6bR,12aS,12bS)-4b,6a,6b,7,8,9,10,12a,12b,13-decahydroindolizino[1,2-c]phenanthridine-12,14-dione (PubChem CID 134840935) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is (4bS,6aS,6bR,12aS,12bS)-4b,6a,6b,7,8,9,10,12a,12b,13-decahydroindolizino[1,2-c]phenanthridine-12,14-dione.
| Compound Name | (4bS,6aS,6bR,12aS,12bS)-4b,6a,6b,7,8,9,10,12a,12b,13-decahydroindolizino[1,2-c]phenanthridine-12,14-dione |
|---|---|
| PubChem CID | 134840935 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (4bS,6aS,6bR,12aS,12bS)-4b,6a,6b,7,8,9,10,12a,12b,13-decahydroindolizino[1,2-c]phenanthridine-12,14-dione |
| SMILES | O=C1N[C@@H]2[C@H]3C(=O)N4CCCC[C@@H]4[C@H]3C=C[C@H]2c2ccccc21 |
| InChI | InChI=1S/C19H20N2O2/c22-18-13-6-2-1-5-11(13)12-8-9-14-15-7-3-4-10-21(15)19(23)16(14)17(12)20-18/h1-2,5-6,8-9,12,14-17H,3-4,7,10H2,(H,20,22)/t12-,14+,15+,16-,17-/m0/s1 |
| InChIKey | FRBKVLRMHHMDND-WFKFIOEPSA-N |
| XLogP | 2.08 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|