C18H18N2O3 — CID 70061489
2-[(7S,10aR)-6-oxo-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-7-yl]isoindole-1,3-dione (PubChem CID 70061489) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2-[(7S,10aR)-6-oxo-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-7-yl]isoindole-1,3-dione.
| Compound Name | 2-[(7S,10aR)-6-oxo-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-7-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 70061489 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2-[(7S,10aR)-6-oxo-2,3,4,7,8,10a-hexahydro-1H-pyrido[1,2-a]azepin-7-yl]isoindole-1,3-dione |
| SMILES | O=C1[C@@H](N2C(=O)c3ccccc3C2=O)CC=C[C@H]2CCCCN12 |
| InChI | InChI=1S/C18H18N2O3/c21-16-13-8-1-2-9-14(13)17(22)20(16)15-10-5-7-12-6-3-4-11-19(12)18(15)23/h1-2,5,7-9,12,15H,3-4,6,10-11H2/t12-,15+/m1/s1 |
| InChIKey | IMFZCYPYKPUGHF-DOMZBBRYSA-N |
| XLogP | 1.99 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|