C13H15NO — CID 2752792
1,2,3,4,11,11a-hexahydrobenzo[b]quinolizin-6-one (PubChem CID 2752792) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1,2,3,4,11,11a-hexahydrobenzo[b]quinolizin-6-one.
| Compound Name | 1,2,3,4,11,11a-hexahydrobenzo[b]quinolizin-6-one |
|---|---|
| PubChem CID | 2752792 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1,2,3,4,11,11a-hexahydrobenzo[b]quinolizin-6-one |
| SMILES | O=C1c2ccccc2CC2CCCCN12 |
| InChI | InChI=1S/C13H15NO/c15-13-12-7-2-1-5-10(12)9-11-6-3-4-8-14(11)13/h1-2,5,7,11H,3-4,6,8-9H2 |
| InChIKey | RMDMKRJRSLNXRR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |