C21H22FNO2 — CID 169173845
(17R)-23-fluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-11-one (PubChem CID 169173845) has the molecular formula C21H22FNO2 and a molecular weight of 339.41 g/mol. Its IUPAC name is (17R)-23-fluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-11-one.
| Compound Name | (17R)-23-fluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-11-one |
|---|---|
| PubChem CID | 169173845 |
| Molecular Formula | C21H22FNO2 |
| Molecular Weight | 339.41 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | (17R)-23-fluoro-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-11-one |
| SMILES | O=C1CCOc2ccccc2-c2cccc(c2F)C[C@H]2CCCCN12 |
| InChI | InChI=1S/C21H22FNO2/c22-21-15-6-5-9-18(21)17-8-1-2-10-19(17)25-13-11-20(24)23-12-4-3-7-16(23)14-15/h1-2,5-6,8-10,16H,3-4,7,11-14H2/t16-/m1/s1 |
| InChIKey | VOWRAWJDDJFHEA-MRXNPFEDSA-N |
| XLogP | 4.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |