C23H25F2N2O4S+ — CID 170293388
fluoromethylsulfonyl-[(16S,17S)-22-fluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]-methylideneazanium (PubChem CID 170293388) has the molecular formula C23H25F2N2O4S+ and a molecular weight of 463.53 g/mol. Its IUPAC name is fluoromethylsulfonyl-[(16S,17S)-22-fluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]-methylideneazanium.
| Compound Name | fluoromethylsulfonyl-[(16S,17S)-22-fluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]-methylideneazanium |
|---|---|
| PubChem CID | 170293388 |
| Molecular Formula | C23H25F2N2O4S+ |
| Molecular Weight | 463.53 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | fluoromethylsulfonyl-[(16S,17S)-22-fluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl]-methylideneazanium |
| SMILES | C=[N+]([C@H]1CCCN2C(=O)CCOc3ccccc3-c3cc(ccc3F)C[C@@H]12)S(=O)(=O)CF |
| InChI | InChI=1S/C23H25F2N2O4S/c1-26(32(29,30)15-24)20-6-4-11-27-21(20)14-16-8-9-19(25)18(13-16)17-5-2-3-7-22(17)31-12-10-23(27)28/h2-3,5,7-9,13,20-21H,1,4,6,10-12,14-15H2/q+1/t20-,21-/m0/s1 |
| InChIKey | BZNNZCNDDLBKDC-SFTDATJTSA-N |
| XLogP | 3.15 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.53 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|