C22H22F4N2O4S — CID 170199859
N-(15,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)-1,1-difluoromethanesulfonamide (PubChem CID 170199859) has the molecular formula C22H22F4N2O4S and a molecular weight of 486.49 g/mol. Its IUPAC name is N-(15,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)-1,1-difluoromethanesulfonamide.
| Compound Name | N-(15,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)-1,1-difluoromethanesulfonamide |
|---|---|
| PubChem CID | 170199859 |
| Molecular Formula | C22H22F4N2O4S |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | N-(15,15-difluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2,4,6,19(23),20-hexaen-16-yl)-1,1-difluoromethanesulfonamide |
| SMILES | O=C1CCOc2ccccc2-c2cccc(c2)CC2C(NS(=O)(=O)C(F)F)C(F)(F)CCN12 |
| InChI | InChI=1S/C22H22F4N2O4S/c23-21(24)33(30,31)27-20-17-13-14-4-3-5-15(12-14)16-6-1-2-7-18(16)32-11-8-19(29)28(17)10-9-22(20,25)26/h1-7,12,17,20-21,27H,8-11,13H2 |
| InChIKey | IDOONPAQGRKIOJ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |