C22H22F4N2O4S — CID 169173948
1-fluoro-N-(6,15,15-trifluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)methanesulfonamide (PubChem CID 169173948) has the molecular formula C22H22F4N2O4S and a molecular weight of 486.49 g/mol. Its IUPAC name is 1-fluoro-N-(6,15,15-trifluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)methanesulfonamide.
| Compound Name | 1-fluoro-N-(6,15,15-trifluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)methanesulfonamide |
|---|---|
| PubChem CID | 169173948 |
| Molecular Formula | C22H22F4N2O4S |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | 1-fluoro-N-(6,15,15-trifluoro-11-oxo-8-oxa-12-azatetracyclo[17.3.1.02,7.012,17]tricosa-1(22),2(7),3,5,19(23),20-hexaen-16-yl)methanesulfonamide |
| SMILES | O=C1CCOc2c(F)cccc2-c2cccc(c2)CC2C(NS(=O)(=O)CF)C(F)(F)CCN12 |
| InChI | InChI=1S/C22H22F4N2O4S/c23-13-33(30,31)27-21-18-12-14-3-1-4-15(11-14)16-5-2-6-17(24)20(16)32-10-7-19(29)28(18)9-8-22(21,25)26/h1-6,11,18,21,27H,7-10,12-13H2 |
| InChIKey | WXFFLPUEFDTGEE-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |